C12H15F9N2O8S3 — CID 166970116
1,1,2,2,3,3-hexafluoro-N-[2-[(2-oxooxolan-3-yl)amino]ethyl]-3-[2-(trifluoromethylsulfonyl)ethylsulfonyl]propane-1-sulfonamide (PubChem CID 166970116) has the molecular formula C12H15F9N2O8S3 and a molecular weight of 582.44 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-N-[2-[(2-oxooxolan-3-yl)amino]ethyl]-3-[2-(trifluoromethylsulfonyl)ethylsulfonyl]propane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3-hexafluoro-N-[2-[(2-oxooxolan-3-yl)amino]ethyl]-3-[2-(trifluoromethylsulfonyl)ethylsulfonyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 166970116 |
| Molecular Formula | C12H15F9N2O8S3 |
| Molecular Weight | 582.44 g/mol |
| Exact Mass | 581.98 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-N-[2-[(2-oxooxolan-3-yl)amino]ethyl]-3-[2-(trifluoromethylsulfonyl)ethylsulfonyl]propane-1-sulfonamide |
| SMILES | O=C1OCCC1NCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)CCS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H15F9N2O8S3/c13-9(14,10(15,16)32(25,26)5-6-33(27,28)12(19,20)21)11(17,18)34(29,30)23-3-2-22-7-1-4-31-8(7)24/h7,22-23H,1-6H2 |
| InChIKey | UTFBDNUWJBILLK-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 152.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.44 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|