About N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide
N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide (PubChem CID 166970134) has the molecular formula C13H18N4OS
and a molecular weight of 278.38 g/mol. Its IUPAC name is N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide |
| PubChem CID | 166970134 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide |
| SMILES | CC[C@H](C)c1cnc(NC(=O)C2CC(NC#N)C2)s1 |
| InChI | InChI=1S/C13H18N4OS/c1-3-8(2)11-6-15-13(19-11)17-12(18)9-4-10(5-9)16-7-14/h6,8-10,16H,3-5H2,1-2H3,(H,15,17,18)/t8-,9?,10?/m0/s1 |
| InChIKey | BIBDQNIIAVDWNW-IDKOKCKLSA-N |
| XLogP | 2.44 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide?
The IUPAC name of N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide (CID 166970134) is N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide.
What is the SMILES notation for N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide?
The canonical SMILES for N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide is CC[C@H](C)c1cnc(NC(=O)C2CC(NC#N)C2)s1.
What is the InChIKey of N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide?
The InChIKey is BIBDQNIIAVDWNW-IDKOKCKLSA-N. The full InChI is InChI=1S/C13H18N4OS/c1-3-8(2)11-6-15-13(19-11)17-12(18)9-4-10(5-9)16-7-14/h6,8-10,16H,3-5H2,1-2H3,(H,15,17,18)/t8-,9?,10?/m0/s1.
What are the key properties of N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide?
N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide has a molecular weight of 278.38 g/mol, XLogP of 2.44, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(2S)-butan-2-yl]-1,3-thiazol-2-yl]-3-(cyanoamino)cyclobutane-1-carboxamide is sourced from PubChem (CID 166970134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).