About (4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine
(4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine (PubChem CID 166970164) has the molecular formula C14H26FN
and a molecular weight of 227.37 g/mol. Its IUPAC name is (4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine.
Molecular Properties
| Compound Name | (4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine |
| PubChem CID | 166970164 |
| Molecular Formula | C14H26FN |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | (4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine |
| SMILES | CC(C)(C)C1C/C(=C/F)CCN1C(C)(C)C |
| InChI | InChI=1S/C14H26FN/c1-13(2,3)12-9-11(10-15)7-8-16(12)14(4,5)6/h10,12H,7-9H2,1-6H3/b11-10+ |
| InChIKey | YFZALCGVQKNTFB-ZHACJKMWSA-N |
| XLogP | 4.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine?
The IUPAC name of (4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine (CID 166970164) is (4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine.
What is the SMILES notation for (4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine?
The canonical SMILES for (4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine is CC(C)(C)C1C/C(=C/F)CCN1C(C)(C)C.
What is the InChIKey of (4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine?
The InChIKey is YFZALCGVQKNTFB-ZHACJKMWSA-N. The full InChI is InChI=1S/C14H26FN/c1-13(2,3)12-9-11(10-15)7-8-16(12)14(4,5)6/h10,12H,7-9H2,1-6H3/b11-10+.
What are the key properties of (4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine?
(4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine has a molecular weight of 227.37 g/mol, XLogP of 4.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-1,2-ditert-butyl-4-(fluoromethylidene)piperidine is sourced from PubChem (CID 166970164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).