About (E)-4-fluoro-N,2-dimethylbut-2-en-1-amine
(E)-4-fluoro-N,2-dimethylbut-2-en-1-amine (PubChem CID 166971141) has the molecular formula C6H12FN
and a molecular weight of 117.17 g/mol. Its IUPAC name is (E)-4-fluoro-N,2-dimethylbut-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-4-fluoro-N,2-dimethylbut-2-en-1-amine |
| PubChem CID | 166971141 |
| Molecular Formula | C6H12FN |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.10 |
| IUPAC Name | (E)-4-fluoro-N,2-dimethylbut-2-en-1-amine |
| SMILES | CNC/C(C)=C/CF |
| InChI | InChI=1S/C6H12FN/c1-6(3-4-7)5-8-2/h3,8H,4-5H2,1-2H3/b6-3+ |
| InChIKey | JTDGLYWTLANSJS-ZZXKWVIFSA-N |
| XLogP | 1.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-fluoro-N,2-dimethylbut-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-fluoro-N,2-dimethylbut-2-en-1-amine?
The IUPAC name of (E)-4-fluoro-N,2-dimethylbut-2-en-1-amine (CID 166971141) is (E)-4-fluoro-N,2-dimethylbut-2-en-1-amine.
What is the SMILES notation for (E)-4-fluoro-N,2-dimethylbut-2-en-1-amine?
The canonical SMILES for (E)-4-fluoro-N,2-dimethylbut-2-en-1-amine is CNC/C(C)=C/CF.
What is the InChIKey of (E)-4-fluoro-N,2-dimethylbut-2-en-1-amine?
The InChIKey is JTDGLYWTLANSJS-ZZXKWVIFSA-N. The full InChI is InChI=1S/C6H12FN/c1-6(3-4-7)5-8-2/h3,8H,4-5H2,1-2H3/b6-3+.
What are the key properties of (E)-4-fluoro-N,2-dimethylbut-2-en-1-amine?
(E)-4-fluoro-N,2-dimethylbut-2-en-1-amine has a molecular weight of 117.17 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-fluoro-N,2-dimethylbut-2-en-1-amine is sourced from PubChem (CID 166971141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).