C28H34N6O2S — CID 166971273
2-amino-8-[2-[2-(methylsulfanylamino)ethyl]-1-oxophthalazin-6-yl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide (PubChem CID 166971273) has the molecular formula C28H34N6O2S and a molecular weight of 518.69 g/mol. Its IUPAC name is 2-amino-8-[2-[2-(methylsulfanylamino)ethyl]-1-oxophthalazin-6-yl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-amino-8-[2-[2-(methylsulfanylamino)ethyl]-1-oxophthalazin-6-yl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 166971273 |
| Molecular Formula | C28H34N6O2S |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 2-amino-8-[2-[2-(methylsulfanylamino)ethyl]-1-oxophthalazin-6-yl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(-c3ccc4c(=O)n(CCNSC)ncc4c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C28H34N6O2S/c1-4-11-33(12-5-2)27(35)22-15-21-7-6-20(16-25(21)32-26(29)17-22)19-8-9-24-23(14-19)18-30-34(28(24)36)13-10-31-37-3/h6-9,14-16,18,31H,4-5,10-13,17H2,1-3H3,(H2,29,32) |
| InChIKey | NPPUOXOUPGXGRG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|