C30H38FN5O4S — CID 166971381
2-amino-6-fluoro-8-[4-formyl-3-[(Z)-[methyl(3-methylsulfonylpropyl)hydrazinylidene]methyl]phenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide (PubChem CID 166971381) has the molecular formula C30H38FN5O4S and a molecular weight of 583.73 g/mol. Its IUPAC name is 2-amino-6-fluoro-8-[4-formyl-3-[(Z)-[methyl(3-methylsulfonylpropyl)hydrazinylidene]methyl]phenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-amino-6-fluoro-8-[4-formyl-3-[(Z)-[methyl(3-methylsulfonylpropyl)hydrazinylidene]methyl]phenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 166971381 |
| Molecular Formula | C30H38FN5O4S |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | 2-amino-6-fluoro-8-[4-formyl-3-[(Z)-[methyl(3-methylsulfonylpropyl)hydrazinylidene]methyl]phenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2c(F)cc(-c3ccc(C=O)c(/C=N\N(C)CCCS(C)(=O)=O)c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C30H38FN5O4S/c1-5-10-36(11-6-2)30(38)24-15-26-27(31)16-23(17-28(26)34-29(32)18-24)21-8-9-22(20-37)25(14-21)19-33-35(3)12-7-13-41(4,39)40/h8-9,14-17,19-20H,5-7,10-13,18H2,1-4H3,(H2,32,34)/b33-19- |
| InChIKey | MWLXLGFGFNYJOQ-APTWKGOFSA-N |
| XLogP | 4.43 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|