C10H9F2N3O2 — CID 166972227
methyl N-(6,6-difluoro-8,9-diazatricyclo[5.3.0.02,5]deca-1(7),3,9-trien-10-yl)carbamate (PubChem CID 166972227) has the molecular formula C10H9F2N3O2 and a molecular weight of 241.20 g/mol. Its IUPAC name is methyl N-(6,6-difluoro-8,9-diazatricyclo[5.3.0.02,5]deca-1(7),3,9-trien-10-yl)carbamate.
| Compound Name | methyl N-(6,6-difluoro-8,9-diazatricyclo[5.3.0.02,5]deca-1(7),3,9-trien-10-yl)carbamate |
|---|---|
| PubChem CID | 166972227 |
| Molecular Formula | C10H9F2N3O2 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | methyl N-(6,6-difluoro-8,9-diazatricyclo[5.3.0.02,5]deca-1(7),3,9-trien-10-yl)carbamate |
| SMILES | COC(=O)Nc1n[nH]c2c1C1C=CC1C2(F)F |
| InChI | InChI=1S/C10H9F2N3O2/c1-17-9(16)13-8-6-4-2-3-5(4)10(11,12)7(6)14-15-8/h2-5H,1H3,(H2,13,14,15,16) |
| InChIKey | RZSCMMWBMCQYRX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|