C19H21ClN2O3S — CID 166972642
1-(5-chloro-6,7-dihydroxy-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-[(2,6-dimethyl-3-pyridinyl)sulfanyl]ethanone (PubChem CID 166972642) has the molecular formula C19H21ClN2O3S and a molecular weight of 392.91 g/mol. Its IUPAC name is 1-(5-chloro-6,7-dihydroxy-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-[(2,6-dimethyl-3-pyridinyl)sulfanyl]ethanone.
| Compound Name | 1-(5-chloro-6,7-dihydroxy-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-[(2,6-dimethyl-3-pyridinyl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 166972642 |
| Molecular Formula | C19H21ClN2O3S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 1-(5-chloro-6,7-dihydroxy-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-[(2,6-dimethyl-3-pyridinyl)sulfanyl]ethanone |
| SMILES | Cc1ccc(SCC(=O)N2CCc3c(Cl)c(O)c(O)c(C)c3C2)c(C)n1 |
| InChI | InChI=1S/C19H21ClN2O3S/c1-10-4-5-15(12(3)21-10)26-9-16(23)22-7-6-13-14(8-22)11(2)18(24)19(25)17(13)20/h4-5,24-25H,6-9H2,1-3H3 |
| InChIKey | JAPGNUPVMZEMGU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|