C19H25N3O3 — CID 166972944
N-formyl-4-[2-methyl-6-oxo-4-[(1Z,3E)-penta-1,3-dienyl]-5-[(Z)-prop-1-enyl]pyrimidin-1-yl]pentanamide (PubChem CID 166972944) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-formyl-4-[2-methyl-6-oxo-4-[(1Z,3E)-penta-1,3-dienyl]-5-[(Z)-prop-1-enyl]pyrimidin-1-yl]pentanamide.
| Compound Name | N-formyl-4-[2-methyl-6-oxo-4-[(1Z,3E)-penta-1,3-dienyl]-5-[(Z)-prop-1-enyl]pyrimidin-1-yl]pentanamide |
|---|---|
| PubChem CID | 166972944 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-formyl-4-[2-methyl-6-oxo-4-[(1Z,3E)-penta-1,3-dienyl]-5-[(Z)-prop-1-enyl]pyrimidin-1-yl]pentanamide |
| SMILES | C/C=C\c1c(/C=C\C=C\C)nc(C)n(C(C)CCC(=O)NC=O)c1=O |
| InChI | InChI=1S/C19H25N3O3/c1-5-7-8-10-17-16(9-6-2)19(25)22(15(4)21-17)14(3)11-12-18(24)20-13-23/h5-10,13-14H,11-12H2,1-4H3,(H,20,23,24)/b7-5+,9-6-,10-8- |
| InChIKey | JJVCCVQHUKHPKD-RFVQMCDWSA-N |
| XLogP | 2.79 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|