C18H34N2 — CID 166972958
1-N,1-N-di(cyclobutyl)-2-N-cyclopentylpentane-1,2-diamine (PubChem CID 166972958) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is 1-N,1-N-di(cyclobutyl)-2-N-cyclopentylpentane-1,2-diamine.
| Compound Name | 1-N,1-N-di(cyclobutyl)-2-N-cyclopentylpentane-1,2-diamine |
|---|---|
| PubChem CID | 166972958 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 1-N,1-N-di(cyclobutyl)-2-N-cyclopentylpentane-1,2-diamine |
| SMILES | CCCC(CN(C1CCC1)C1CCC1)NC1CCCC1 |
| InChI | InChI=1S/C18H34N2/c1-2-7-16(19-15-8-3-4-9-15)14-20(17-10-5-11-17)18-12-6-13-18/h15-19H,2-14H2,1H3 |
| InChIKey | VNPQTTAYSVOLGR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |