C14H16N4 — CID 166973242
3,3-dimethyl-1-(4-methyl-1,3,5-triazin-2-yl)-2H-indole (PubChem CID 166973242) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 3,3-dimethyl-1-(4-methyl-1,3,5-triazin-2-yl)-2H-indole.
| Compound Name | 3,3-dimethyl-1-(4-methyl-1,3,5-triazin-2-yl)-2H-indole |
|---|---|
| PubChem CID | 166973242 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3,3-dimethyl-1-(4-methyl-1,3,5-triazin-2-yl)-2H-indole |
| SMILES | Cc1ncnc(N2CC(C)(C)c3ccccc32)n1 |
| InChI | InChI=1S/C14H16N4/c1-10-15-9-16-13(17-10)18-8-14(2,3)11-6-4-5-7-12(11)18/h4-7,9H,8H2,1-3H3 |
| InChIKey | REWLPLHKTKDMDX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |