C23H20N6OS — CID 166973313
1-[3-[4-amino-5-[2-(2-methyl-1,3-benzothiazol-5-yl)ethynyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 166973313) has the molecular formula C23H20N6OS and a molecular weight of 428.52 g/mol. Its IUPAC name is 1-[3-[4-amino-5-[2-(2-methyl-1,3-benzothiazol-5-yl)ethynyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-5-[2-(2-methyl-1,3-benzothiazol-5-yl)ethynyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166973313 |
| Molecular Formula | C23H20N6OS |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 1-[3-[4-amino-5-[2-(2-methyl-1,3-benzothiazol-5-yl)ethynyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(c2cc(C#Cc3ccc4sc(C)nc4c3)c3c(N)ncnn23)C1 |
| InChI | InChI=1S/C23H20N6OS/c1-3-21(30)28-9-8-17(12-28)19-11-16(22-23(24)25-13-26-29(19)22)6-4-15-5-7-20-18(10-15)27-14(2)31-20/h3,5,7,10-11,13,17H,1,8-9,12H2,2H3,(H2,24,25,26) |
| InChIKey | QHQKSCDKGCMZRP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|