C15H22FNO — CID 166973422
(3S,4S)-4-[(3E)-5-fluoro-4,5-dimethylhexa-1,3-dien-2-yl]-3-prop-1-en-2-ylpyrrolidin-2-one (PubChem CID 166973422) has the molecular formula C15H22FNO and a molecular weight of 251.34 g/mol. Its IUPAC name is (3S,4S)-4-[(3E)-5-fluoro-4,5-dimethylhexa-1,3-dien-2-yl]-3-prop-1-en-2-ylpyrrolidin-2-one.
| Compound Name | (3S,4S)-4-[(3E)-5-fluoro-4,5-dimethylhexa-1,3-dien-2-yl]-3-prop-1-en-2-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 166973422 |
| Molecular Formula | C15H22FNO |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (3S,4S)-4-[(3E)-5-fluoro-4,5-dimethylhexa-1,3-dien-2-yl]-3-prop-1-en-2-ylpyrrolidin-2-one |
| SMILES | C=C(C)[C@H]1C(=O)NC[C@@H]1C(=C)/C=C(\C)C(C)(C)F |
| InChI | InChI=1S/C15H22FNO/c1-9(2)13-12(8-17-14(13)18)10(3)7-11(4)15(5,6)16/h7,12-13H,1,3,8H2,2,4-6H3,(H,17,18)/b11-7+/t12-,13-/m1/s1 |
| InChIKey | RKNSGDKQSHUVTK-PGJRDNSLSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|