C25H40P2 — CID 166973646
(10R)-7,9-dimethyl-3,13-di(propan-2-yl)-2,14-diphosphatetracyclo[13.4.0.02,6.010,14]nonadeca-1(19),15,17-triene (PubChem CID 166973646) has the molecular formula C25H40P2 and a molecular weight of 402.54 g/mol. Its IUPAC name is (10R)-7,9-dimethyl-3,13-di(propan-2-yl)-2,14-diphosphatetracyclo[13.4.0.02,6.010,14]nonadeca-1(19),15,17-triene.
| Compound Name | (10R)-7,9-dimethyl-3,13-di(propan-2-yl)-2,14-diphosphatetracyclo[13.4.0.02,6.010,14]nonadeca-1(19),15,17-triene |
|---|---|
| PubChem CID | 166973646 |
| Molecular Formula | C25H40P2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (10R)-7,9-dimethyl-3,13-di(propan-2-yl)-2,14-diphosphatetracyclo[13.4.0.02,6.010,14]nonadeca-1(19),15,17-triene |
| SMILES | CC(C)C1CCC2C(C)CC(C)[C@H]3CCC(C(C)C)P3c3ccccc3P12 |
| InChI | InChI=1S/C25H40P2/c1-16(2)20-11-13-22-18(5)15-19(6)23-14-12-21(17(3)4)27(23)25-10-8-7-9-24(25)26(20)22/h7-10,16-23H,11-15H2,1-6H3/t18?,19?,20?,21?,22-,23?,26?,27?/m1/s1 |
| InChIKey | KAZGZADFRASHBT-FCWLIYGPSA-N |
| XLogP | 6.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|