C30H10F4N4O4S — CID 166973687
2-[[2-[(5,6-difluoro-1,3-dioxoinden-2-ylidene)methyl]-10-sulfanylpyrazino[2,3-g]quinoxalin-7-yl]methylidene]-5,6-difluoroindene-1,3-dione (PubChem CID 166973687) has the molecular formula C30H10F4N4O4S and a molecular weight of 598.49 g/mol. Its IUPAC name is 2-[[2-[(5,6-difluoro-1,3-dioxoinden-2-ylidene)methyl]-10-sulfanylpyrazino[2,3-g]quinoxalin-7-yl]methylidene]-5,6-difluoroindene-1,3-dione.
| Compound Name | 2-[[2-[(5,6-difluoro-1,3-dioxoinden-2-ylidene)methyl]-10-sulfanylpyrazino[2,3-g]quinoxalin-7-yl]methylidene]-5,6-difluoroindene-1,3-dione |
|---|---|
| PubChem CID | 166973687 |
| Molecular Formula | C30H10F4N4O4S |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 598.04 |
| IUPAC Name | 2-[[2-[(5,6-difluoro-1,3-dioxoinden-2-ylidene)methyl]-10-sulfanylpyrazino[2,3-g]quinoxalin-7-yl]methylidene]-5,6-difluoroindene-1,3-dione |
| SMILES | O=C1C(=Cc2cnc3c(S)c4nc(C=C5C(=O)c6cc(F)c(F)cc6C5=O)cnc4cc3n2)C(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C30H10F4N4O4S/c31-18-3-12-13(4-19(18)32)27(40)16(26(12)39)1-10-9-36-24-23(37-10)7-22-25(30(24)43)38-11(8-35-22)2-17-28(41)14-5-20(33)21(34)6-15(14)29(17)42/h1-9,43H |
| InChIKey | UCWOPXMEMZMYHJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|