About 4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine
4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine (PubChem CID 166973893) has the molecular formula C9H10ClFN2O2S
and a molecular weight of 264.71 g/mol. Its IUPAC name is 4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine |
| PubChem CID | 166973893 |
| Molecular Formula | C9H10ClFN2O2S |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine |
| SMILES | CSc1nc(Cl)cc(O[C@H]2COC[C@H]2F)n1 |
| InChI | InChI=1S/C9H10ClFN2O2S/c1-16-9-12-7(10)2-8(13-9)15-6-4-14-3-5(6)11/h2,5-6H,3-4H2,1H3/t5-,6+/m1/s1 |
| InChIKey | SYVJACTUVXSQOS-RITPCOANSA-N |
| XLogP | 1.97 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine?
The IUPAC name of 4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine (CID 166973893) is 4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine.
What is the SMILES notation for 4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine?
The canonical SMILES for 4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine is CSc1nc(Cl)cc(O[C@H]2COC[C@H]2F)n1.
What is the InChIKey of 4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine?
The InChIKey is SYVJACTUVXSQOS-RITPCOANSA-N. The full InChI is InChI=1S/C9H10ClFN2O2S/c1-16-9-12-7(10)2-8(13-9)15-6-4-14-3-5(6)11/h2,5-6H,3-4H2,1H3/t5-,6+/m1/s1.
What are the key properties of 4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine?
4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine has a molecular weight of 264.71 g/mol, XLogP of 1.97, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-[(3S,4R)-4-fluorooxolan-3-yl]oxy-2-methylsulfanylpyrimidine is sourced from PubChem (CID 166973893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).