C15H27N — CID 166973899
N-[(4E)-3,4-dimethylhepta-4,6-dien-2-yl]-2,3-dimethylbutan-1-imine (PubChem CID 166973899) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is N-[(4E)-3,4-dimethylhepta-4,6-dien-2-yl]-2,3-dimethylbutan-1-imine.
| Compound Name | N-[(4E)-3,4-dimethylhepta-4,6-dien-2-yl]-2,3-dimethylbutan-1-imine |
|---|---|
| PubChem CID | 166973899 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | N-[(4E)-3,4-dimethylhepta-4,6-dien-2-yl]-2,3-dimethylbutan-1-imine |
| SMILES | C=C/C=C(\C)C(C)C(C)/N=C/C(C)C(C)C |
| InChI | InChI=1S/C15H27N/c1-8-9-12(4)14(6)15(7)16-10-13(5)11(2)3/h8-11,13-15H,1H2,2-7H3/b12-9+,16-10+ |
| InChIKey | YBYXEDWCRGCNIC-JXTNESPGSA-N |
| XLogP | 4.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|