C10H5F7 — CID 166974166
1,2,3,5-tetrafluoro-4-prop-1-en-2-yl-6-(trifluoromethyl)benzene (PubChem CID 166974166) has the molecular formula C10H5F7 and a molecular weight of 258.14 g/mol. Its IUPAC name is 1,2,3,5-tetrafluoro-4-prop-1-en-2-yl-6-(trifluoromethyl)benzene.
| Compound Name | 1,2,3,5-tetrafluoro-4-prop-1-en-2-yl-6-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 166974166 |
| Molecular Formula | C10H5F7 |
| Molecular Weight | 258.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 1,2,3,5-tetrafluoro-4-prop-1-en-2-yl-6-(trifluoromethyl)benzene |
| SMILES | C=C(C)c1c(F)c(F)c(F)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C10H5F7/c1-3(2)4-6(11)5(10(15,16)17)8(13)9(14)7(4)12/h1H2,2H3 |
| InChIKey | WMFXIZRSPAMRDC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.14 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|