C8H6F4IN — CID 166974271
2,3,5,6-tetrafluoro-N-iodo-N,4-dimethylaniline (PubChem CID 166974271) has the molecular formula C8H6F4IN and a molecular weight of 319.04 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-iodo-N,4-dimethylaniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-iodo-N,4-dimethylaniline |
|---|---|
| PubChem CID | 166974271 |
| Molecular Formula | C8H6F4IN |
| Molecular Weight | 319.04 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-iodo-N,4-dimethylaniline |
| SMILES | Cc1c(F)c(F)c(N(C)I)c(F)c1F |
| InChI | InChI=1S/C8H6F4IN/c1-3-4(9)6(11)8(14(2)13)7(12)5(3)10/h1-2H3 |
| InChIKey | XTMUQTALLLSJLG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.04 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|