About dibenzothiophene-2,3,7-triamine
dibenzothiophene-2,3,7-triamine (PubChem CID 166974357) has the molecular formula C12H11N3S
and a molecular weight of 229.31 g/mol. Its IUPAC name is dibenzothiophene-2,3,7-triamine.
Molecular Properties
| Compound Name | dibenzothiophene-2,3,7-triamine |
| PubChem CID | 166974357 |
| Molecular Formula | C12H11N3S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | dibenzothiophene-2,3,7-triamine |
| SMILES | Nc1ccc2c(c1)sc1cc(N)c(N)cc12 |
| InChI | InChI=1S/C12H11N3S/c13-6-1-2-7-8-4-9(14)10(15)5-12(8)16-11(7)3-6/h1-5H,13-15H2 |
| InChIKey | DJBCCAWCMCXDBM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze dibenzothiophene-2,3,7-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzothiophene-2,3,7-triamine?
The IUPAC name of dibenzothiophene-2,3,7-triamine (CID 166974357) is dibenzothiophene-2,3,7-triamine.
What is the SMILES notation for dibenzothiophene-2,3,7-triamine?
The canonical SMILES for dibenzothiophene-2,3,7-triamine is Nc1ccc2c(c1)sc1cc(N)c(N)cc12.
What is the InChIKey of dibenzothiophene-2,3,7-triamine?
The InChIKey is DJBCCAWCMCXDBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3S/c13-6-1-2-7-8-4-9(14)10(15)5-12(8)16-11(7)3-6/h1-5H,13-15H2.
What are the key properties of dibenzothiophene-2,3,7-triamine?
dibenzothiophene-2,3,7-triamine has a molecular weight of 229.31 g/mol, XLogP of 2.80, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzothiophene-2,3,7-triamine is sourced from PubChem (CID 166974357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).