C22H28N2O4 — CID 166974497
2,6-bis(3-methylpentan-3-yl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 166974497) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2,6-bis(3-methylpentan-3-yl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis(3-methylpentan-3-yl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 166974497 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2,6-bis(3-methylpentan-3-yl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CCC(C)(CC)n1c(=O)c2cc3c(=O)n(C(C)(CC)CC)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C22H28N2O4/c1-7-21(5,8-2)23-17(25)13-11-15-16(12-14(13)18(23)26)20(28)24(19(15)27)22(6,9-3)10-4/h11-12H,7-10H2,1-6H3 |
| InChIKey | ADVRARIFRNIYPL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |