C21H25FN2O3 — CID 166975061
(2R,3R,4R,5R)-2-[4-(cyclobutylmethyl)phenyl]-5-[(6-fluoro-2-pyridinyl)amino]oxane-3,4-diol (PubChem CID 166975061) has the molecular formula C21H25FN2O3 and a molecular weight of 372.44 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[4-(cyclobutylmethyl)phenyl]-5-[(6-fluoro-2-pyridinyl)amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-[4-(cyclobutylmethyl)phenyl]-5-[(6-fluoro-2-pyridinyl)amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 166975061 |
| Molecular Formula | C21H25FN2O3 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (2R,3R,4R,5R)-2-[4-(cyclobutylmethyl)phenyl]-5-[(6-fluoro-2-pyridinyl)amino]oxane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@H](Nc2cccc(F)n2)CO[C@@H]1c1ccc(CC2CCC2)cc1 |
| InChI | InChI=1S/C21H25FN2O3/c22-17-5-2-6-18(24-17)23-16-12-27-21(20(26)19(16)25)15-9-7-14(8-10-15)11-13-3-1-4-13/h2,5-10,13,16,19-21,25-26H,1,3-4,11-12H2,(H,23,24)/t16-,19-,20-,21-/m1/s1 |
| InChIKey | HRHXLEMEXGCJBF-QYRPDUKASA-N |
| XLogP | 2.84 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|