About propyl-(2,4,6-tritert-butylphenyl)phosphane
propyl-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 16697508) has the molecular formula C21H37P
and a molecular weight of 320.50 g/mol. Its IUPAC name is propyl-(2,4,6-tritert-butylphenyl)phosphane.
Molecular Properties
| Compound Name | propyl-(2,4,6-tritert-butylphenyl)phosphane |
| PubChem CID | 16697508 |
| Molecular Formula | C21H37P |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | propyl-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CCCPc1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C21H37P/c1-11-12-22-18-16(20(5,6)7)13-15(19(2,3)4)14-17(18)21(8,9)10/h13-14,22H,11-12H2,1-10H3 |
| InChIKey | YWFOHVBSGOEFHC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze propyl-(2,4,6-tritert-butylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl-(2,4,6-tritert-butylphenyl)phosphane?
The IUPAC name of propyl-(2,4,6-tritert-butylphenyl)phosphane (CID 16697508) is propyl-(2,4,6-tritert-butylphenyl)phosphane.
What is the SMILES notation for propyl-(2,4,6-tritert-butylphenyl)phosphane?
The canonical SMILES for propyl-(2,4,6-tritert-butylphenyl)phosphane is CCCPc1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of propyl-(2,4,6-tritert-butylphenyl)phosphane?
The InChIKey is YWFOHVBSGOEFHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37P/c1-11-12-22-18-16(20(5,6)7)13-15(19(2,3)4)14-17(18)21(8,9)10/h13-14,22H,11-12H2,1-10H3.
What are the key properties of propyl-(2,4,6-tritert-butylphenyl)phosphane?
propyl-(2,4,6-tritert-butylphenyl)phosphane has a molecular weight of 320.50 g/mol, XLogP of 6.29, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for propyl-(2,4,6-tritert-butylphenyl)phosphane is sourced from PubChem (CID 16697508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).