C13H22N4O6S — CID 166975421
(2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-methoxy-5-[(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)amino]oxane-3,4-diol (PubChem CID 166975421) has the molecular formula C13H22N4O6S and a molecular weight of 362.41 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-methoxy-5-[(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-methoxy-5-[(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 166975421 |
| Molecular Formula | C13H22N4O6S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-methoxy-5-[(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)amino]oxane-3,4-diol |
| SMILES | CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1Nc1nc(N2CCOCC2)ns1 |
| InChI | InChI=1S/C13H22N4O6S/c1-21-11-8(10(20)9(19)7(6-18)23-11)14-13-15-12(16-24-13)17-2-4-22-5-3-17/h7-11,18-20H,2-6H2,1H3,(H,14,15,16)/t7-,8-,9+,10-,11-/m1/s1 |
| InChIKey | JWLMLRORAUEPAU-KAMPLNKDSA-N |
| XLogP | -1.76 |
| TPSA | 129.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |