C18H28N4O4S — CID 166975429
(1S,4R,5S)-1-[3-(2-cyclobutylethyl)cyclopentyl]-4-(1,2,3,5-thiatriazol-4-ylamino)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 166975429) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is (1S,4R,5S)-1-[3-(2-cyclobutylethyl)cyclopentyl]-4-(1,2,3,5-thiatriazol-4-ylamino)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,4R,5S)-1-[3-(2-cyclobutylethyl)cyclopentyl]-4-(1,2,3,5-thiatriazol-4-ylamino)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 166975429 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (1S,4R,5S)-1-[3-(2-cyclobutylethyl)cyclopentyl]-4-(1,2,3,5-thiatriazol-4-ylamino)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | OC1C(O)[C@]2(C3CCC(CCC4CCC4)C3)CO[C@@H](O2)[C@@H]1Nc1nnsn1 |
| InChI | InChI=1S/C18H28N4O4S/c23-14-13(19-17-20-22-27-21-17)16-25-9-18(26-16,15(14)24)12-7-6-11(8-12)5-4-10-2-1-3-10/h10-16,23-24H,1-9H2,(H,19,21)/t11?,12?,13-,14?,15?,16+,18-/m1/s1 |
| InChIKey | GIQHTZQWHJWQTF-OMDQMQMMSA-N |
| XLogP | 1.56 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |