C12H17FN2O5 — CID 166975434
(2R,3R,4R,6R)-5-[(6-fluoro-2-pyridinyl)amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol (PubChem CID 166975434) has the molecular formula C12H17FN2O5 and a molecular weight of 288.28 g/mol. Its IUPAC name is (2R,3R,4R,6R)-5-[(6-fluoro-2-pyridinyl)amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol.
| Compound Name | (2R,3R,4R,6R)-5-[(6-fluoro-2-pyridinyl)amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 166975434 |
| Molecular Formula | C12H17FN2O5 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (2R,3R,4R,6R)-5-[(6-fluoro-2-pyridinyl)amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol |
| SMILES | CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)C1Nc1cccc(F)n1 |
| InChI | InChI=1S/C12H17FN2O5/c1-19-12-9(11(18)10(17)6(5-16)20-12)15-8-4-2-3-7(13)14-8/h2-4,6,9-12,16-18H,5H2,1H3,(H,14,15)/t6-,9?,10+,11-,12-/m1/s1 |
| InChIKey | UYIXYBNIILJAQH-NHGGGXDGSA-N |
| XLogP | -0.91 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|