About 5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile
5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile (PubChem CID 166975504) has the molecular formula C9H7N3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile |
| PubChem CID | 166975504 |
| Molecular Formula | C9H7N3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile |
| SMILES | CCc1ccc2sc(C#N)nc2n1 |
| InChI | InChI=1S/C9H7N3S/c1-2-6-3-4-7-9(11-6)12-8(5-10)13-7/h3-4H,2H2,1H3 |
| InChIKey | XUIFGLISYYTDRV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile?
The IUPAC name of 5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile (CID 166975504) is 5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile.
What is the SMILES notation for 5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile?
The canonical SMILES for 5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile is CCc1ccc2sc(C#N)nc2n1.
What is the InChIKey of 5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile?
The InChIKey is XUIFGLISYYTDRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3S/c1-2-6-3-4-7-9(11-6)12-8(5-10)13-7/h3-4H,2H2,1H3.
What are the key properties of 5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile?
5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile has a molecular weight of 189.24 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-[1,3]thiazolo[4,5-b]pyridine-2-carbonitrile is sourced from PubChem (CID 166975504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).