C12H16ClFN2O5 — CID 166975640
(2R,3R,4R,5R,6R)-5-[(5-chloro-3-fluoro-2-pyridinyl)amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol (PubChem CID 166975640) has the molecular formula C12H16ClFN2O5 and a molecular weight of 322.72 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-5-[(5-chloro-3-fluoro-2-pyridinyl)amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6R)-5-[(5-chloro-3-fluoro-2-pyridinyl)amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 166975640 |
| Molecular Formula | C12H16ClFN2O5 |
| Molecular Weight | 322.72 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | (2R,3R,4R,5R,6R)-5-[(5-chloro-3-fluoro-2-pyridinyl)amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol |
| SMILES | CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1Nc1ncc(Cl)cc1F |
| InChI | InChI=1S/C12H16ClFN2O5/c1-20-12-8(10(19)9(18)7(4-17)21-12)16-11-6(14)2-5(13)3-15-11/h2-3,7-10,12,17-19H,4H2,1H3,(H,15,16)/t7-,8-,9+,10-,12-/m1/s1 |
| InChIKey | HTBARMGNLMGUQP-WSOSLHDDSA-N |
| XLogP | -0.26 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.72 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |