C14H20F2 — CID 166976431
(2E,5E,6Z)-5-ethylidene-4,4-difluoro-8-methylideneundeca-2,6-diene (PubChem CID 166976431) has the molecular formula C14H20F2 and a molecular weight of 226.31 g/mol. Its IUPAC name is (2E,5E,6Z)-5-ethylidene-4,4-difluoro-8-methylideneundeca-2,6-diene.
| Compound Name | (2E,5E,6Z)-5-ethylidene-4,4-difluoro-8-methylideneundeca-2,6-diene |
|---|---|
| PubChem CID | 166976431 |
| Molecular Formula | C14H20F2 |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | (2E,5E,6Z)-5-ethylidene-4,4-difluoro-8-methylideneundeca-2,6-diene |
| SMILES | C=C(/C=C\C(=C/C)C(F)(F)/C=C/C)CCC |
| InChI | InChI=1S/C14H20F2/c1-5-8-12(4)9-10-13(7-3)14(15,16)11-6-2/h6-7,9-11H,4-5,8H2,1-3H3/b10-9-,11-6+,13-7+ |
| InChIKey | ZVPCCHBMICLYNP-FQHCDIAWSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|