About 3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine
3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine (PubChem CID 166976434) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine.
Molecular Properties
| Compound Name | 3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine |
| PubChem CID | 166976434 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine |
| SMILES | C=C=CC(=C)C1=C(C=C)C(C)=NC=CC1=C |
| InChI | InChI=1S/C15H15N/c1-6-8-11(3)15-12(4)9-10-16-13(5)14(15)7-2/h7-10H,1-4H2,5H3 |
| InChIKey | OFHHNSLKIGTWRQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine?
The IUPAC name of 3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine (CID 166976434) is 3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine.
What is the SMILES notation for 3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine?
The canonical SMILES for 3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine is C=C=CC(=C)C1=C(C=C)C(C)=NC=CC1=C.
What is the InChIKey of 3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine?
The InChIKey is OFHHNSLKIGTWRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N/c1-6-8-11(3)15-12(4)9-10-16-13(5)14(15)7-2/h7-10H,1-4H2,5H3.
What are the key properties of 3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine?
3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine has a molecular weight of 209.29 g/mol, XLogP of 3.91, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-2-methyl-5-methylidene-4-penta-1,3,4-trien-2-ylazepine is sourced from PubChem (CID 166976434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).