About 6-methyl-1,3,6,2λ2-dioxazastannocane
6-methyl-1,3,6,2λ2-dioxazastannocane (PubChem CID 16697648) has the molecular formula C5H11NO2Sn
and a molecular weight of 235.86 g/mol. Its IUPAC name is 6-methyl-1,3,6,2λ2-dioxazastannocane.
Molecular Properties
| Compound Name | 6-methyl-1,3,6,2λ2-dioxazastannocane |
| PubChem CID | 16697648 |
| Molecular Formula | C5H11NO2Sn |
| Molecular Weight | 235.86 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | 6-methyl-1,3,6,2λ2-dioxazastannocane |
| SMILES | CN1CCO[Sn]OCC1 |
| InChI | InChI=1S/C5H11NO2.Sn/c1-6(2-4-7)3-5-8;/h2-5H2,1H3;/q-2;+2 |
| InChIKey | QUXMKHBWDKINCJ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.86 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-1,3,6,2λ2-dioxazastannocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,3,6,2λ2-dioxazastannocane?
The IUPAC name of 6-methyl-1,3,6,2λ2-dioxazastannocane (CID 16697648) is 6-methyl-1,3,6,2λ2-dioxazastannocane.
What is the SMILES notation for 6-methyl-1,3,6,2λ2-dioxazastannocane?
The canonical SMILES for 6-methyl-1,3,6,2λ2-dioxazastannocane is CN1CCO[Sn]OCC1.
What is the InChIKey of 6-methyl-1,3,6,2λ2-dioxazastannocane?
The InChIKey is QUXMKHBWDKINCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.Sn/c1-6(2-4-7)3-5-8;/h2-5H2,1H3;/q-2;+2.
What are the key properties of 6-methyl-1,3,6,2λ2-dioxazastannocane?
6-methyl-1,3,6,2λ2-dioxazastannocane has a molecular weight of 235.86 g/mol, XLogP of -0.50, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,3,6,2λ2-dioxazastannocane is sourced from PubChem (CID 16697648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).