C14H21N — CID 166976486
(2E,5E)-1-cyclopropyl-3-methyl-N-prop-1-en-2-ylhepta-2,5-dien-1-imine (PubChem CID 166976486) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (2E,5E)-1-cyclopropyl-3-methyl-N-prop-1-en-2-ylhepta-2,5-dien-1-imine.
| Compound Name | (2E,5E)-1-cyclopropyl-3-methyl-N-prop-1-en-2-ylhepta-2,5-dien-1-imine |
|---|---|
| PubChem CID | 166976486 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (2E,5E)-1-cyclopropyl-3-methyl-N-prop-1-en-2-ylhepta-2,5-dien-1-imine |
| SMILES | C=C(C)/N=C(/C=C(\C)C/C=C/C)C1CC1 |
| InChI | InChI=1S/C14H21N/c1-5-6-7-12(4)10-14(13-8-9-13)15-11(2)3/h5-6,10,13H,2,7-9H2,1,3-4H3/b6-5+,12-10+,15-14- |
| InChIKey | CPEFLKXTRNMZSB-JOSBRJBFSA-N |
| XLogP | 4.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|