About 5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine
5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine (PubChem CID 166976487) has the molecular formula C8H7FN2
and a molecular weight of 150.16 g/mol. Its IUPAC name is 5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine.
Molecular Properties
| Compound Name | 5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine |
| PubChem CID | 166976487 |
| Molecular Formula | C8H7FN2 |
| Molecular Weight | 150.16 g/mol |
| Exact Mass | 150.06 |
| IUPAC Name | 5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine |
| SMILES | C=C=Cc1ncnc(C)c1F |
| InChI | InChI=1S/C8H7FN2/c1-3-4-7-8(9)6(2)10-5-11-7/h4-5H,1H2,2H3 |
| InChIKey | AWCGBHFSCPAXFC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.16 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine?
The IUPAC name of 5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine (CID 166976487) is 5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine.
What is the SMILES notation for 5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine?
The canonical SMILES for 5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine is C=C=Cc1ncnc(C)c1F.
What is the InChIKey of 5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine?
The InChIKey is AWCGBHFSCPAXFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN2/c1-3-4-7-8(9)6(2)10-5-11-7/h4-5H,1H2,2H3.
What are the key properties of 5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine?
5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine has a molecular weight of 150.16 g/mol, XLogP of 1.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-methyl-6-propa-1,2-dienylpyrimidine is sourced from PubChem (CID 166976487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).