About (2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine
(2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine (PubChem CID 166976488) has the molecular formula C11H16FN
and a molecular weight of 181.25 g/mol. Its IUPAC name is (2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine.
Molecular Properties
| Compound Name | (2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine |
| PubChem CID | 166976488 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | (2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine |
| SMILES | CCC/C1=C(F)/C(C)=N\C=C/CC1 |
| InChI | InChI=1S/C11H16FN/c1-3-6-10-7-4-5-8-13-9(2)11(10)12/h5,8H,3-4,6-7H2,1-2H3/b8-5-,11-10+,13-9- |
| InChIKey | REVVBXRAXWZPFQ-UOLHGIRDSA-N |
| XLogP | 3.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine?
The IUPAC name of (2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine (CID 166976488) is (2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine.
What is the SMILES notation for (2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine?
The canonical SMILES for (2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine is CCC/C1=C(F)/C(C)=N\C=C/CC1.
What is the InChIKey of (2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine?
The InChIKey is REVVBXRAXWZPFQ-UOLHGIRDSA-N. The full InChI is InChI=1S/C11H16FN/c1-3-6-10-7-4-5-8-13-9(2)11(10)12/h5,8H,3-4,6-7H2,1-2H3/b8-5-,11-10+,13-9-.
What are the key properties of (2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine?
(2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine has a molecular weight of 181.25 g/mol, XLogP of 3.78, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,6E)-7-fluoro-8-methyl-6-propyl-4,5-dihydroazocine is sourced from PubChem (CID 166976488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).