About 2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene
2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene (PubChem CID 166976495) has the molecular formula C12H16F2
and a molecular weight of 198.26 g/mol. Its IUPAC name is 2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene |
| PubChem CID | 166976495 |
| Molecular Formula | C12H16F2 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene |
| SMILES | C=CC(F)(F)C1=CC(C)C(CC)C=C1 |
| InChI | InChI=1S/C12H16F2/c1-4-10-6-7-11(8-9(10)3)12(13,14)5-2/h5-10H,2,4H2,1,3H3 |
| InChIKey | KXESUFOCJQRKJZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene?
The IUPAC name of 2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene (CID 166976495) is 2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene.
What is the SMILES notation for 2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene?
The canonical SMILES for 2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene is C=CC(F)(F)C1=CC(C)C(CC)C=C1.
What is the InChIKey of 2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene?
The InChIKey is KXESUFOCJQRKJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2/c1-4-10-6-7-11(8-9(10)3)12(13,14)5-2/h5-10H,2,4H2,1,3H3.
What are the key properties of 2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene?
2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene has a molecular weight of 198.26 g/mol, XLogP of 3.97, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoroprop-2-enyl)-5-ethyl-6-methylcyclohexa-1,3-diene is sourced from PubChem (CID 166976495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).