C16H28FN — CID 166976507
5,7-diethyl-4-fluoro-N,8-dimethyldeca-1,8,9-trien-4-amine (PubChem CID 166976507) has the molecular formula C16H28FN and a molecular weight of 253.40 g/mol. Its IUPAC name is 5,7-diethyl-4-fluoro-N,8-dimethyldeca-1,8,9-trien-4-amine.
| Compound Name | 5,7-diethyl-4-fluoro-N,8-dimethyldeca-1,8,9-trien-4-amine |
|---|---|
| PubChem CID | 166976507 |
| Molecular Formula | C16H28FN |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 5,7-diethyl-4-fluoro-N,8-dimethyldeca-1,8,9-trien-4-amine |
| SMILES | C=C=C(C)C(CC)CC(CC)C(F)(CC=C)NC |
| InChI | InChI=1S/C16H28FN/c1-7-11-16(17,18-6)15(10-4)12-14(9-3)13(5)8-2/h7,14-15,18H,1-2,9-12H2,3-6H3 |
| InChIKey | YMHZFBFLCCMUNI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|