C11H16FN — CID 166976510
N-[(2E,4Z,5E)-4-ethylidene-3-fluorohepta-2,5-dien-2-yl]ethanimine (PubChem CID 166976510) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is N-[(2E,4Z,5E)-4-ethylidene-3-fluorohepta-2,5-dien-2-yl]ethanimine.
| Compound Name | N-[(2E,4Z,5E)-4-ethylidene-3-fluorohepta-2,5-dien-2-yl]ethanimine |
|---|---|
| PubChem CID | 166976510 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | N-[(2E,4Z,5E)-4-ethylidene-3-fluorohepta-2,5-dien-2-yl]ethanimine |
| SMILES | C/C=C(/C=C/C)C(\F)=C(C)/N=C/C |
| InChI | InChI=1S/C11H16FN/c1-5-8-10(6-2)11(12)9(4)13-7-3/h5-8H,1-4H3/b8-5+,10-6-,11-9+,13-7+ |
| InChIKey | MGJQZARIDCSYTL-IFNHVIJVSA-N |
| XLogP | 3.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|