C26H30FN5O3 — CID 166976836
N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)phenyl]-4-fluoro-2-methylidenebutanamide (PubChem CID 166976836) has the molecular formula C26H30FN5O3 and a molecular weight of 479.56 g/mol. Its IUPAC name is N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)phenyl]-4-fluoro-2-methylidenebutanamide.
| Compound Name | N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)phenyl]-4-fluoro-2-methylidenebutanamide |
|---|---|
| PubChem CID | 166976836 |
| Molecular Formula | C26H30FN5O3 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)phenyl]-4-fluoro-2-methylidenebutanamide |
| SMILES | C=C(CCF)C(=O)N(CCCCCc1nc(C2CC2)no1)c1cccc(-c2nnc(C3CC3)o2)c1 |
| InChI | InChI=1S/C26H30FN5O3/c1-17(13-14-27)26(33)32(15-4-2-3-8-22-28-23(31-35-22)18-9-10-18)21-7-5-6-20(16-21)25-30-29-24(34-25)19-11-12-19/h5-7,16,18-19H,1-4,8-15H2 |
| InChIKey | UIPRMJIAYOJLNU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 98.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|