About 5-(5-methyl-1,3-oxazol-2-yl)pentanal
5-(5-methyl-1,3-oxazol-2-yl)pentanal (PubChem CID 166976909) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 5-(5-methyl-1,3-oxazol-2-yl)pentanal.
Molecular Properties
| Compound Name | 5-(5-methyl-1,3-oxazol-2-yl)pentanal |
| PubChem CID | 166976909 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 5-(5-methyl-1,3-oxazol-2-yl)pentanal |
| SMILES | Cc1cnc(CCCCC=O)o1 |
| InChI | InChI=1S/C9H13NO2/c1-8-7-10-9(12-8)5-3-2-4-6-11/h6-7H,2-5H2,1H3 |
| InChIKey | CVKNBQSGLVWPKK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-methyl-1,3-oxazol-2-yl)pentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-methyl-1,3-oxazol-2-yl)pentanal?
The IUPAC name of 5-(5-methyl-1,3-oxazol-2-yl)pentanal (CID 166976909) is 5-(5-methyl-1,3-oxazol-2-yl)pentanal.
What is the SMILES notation for 5-(5-methyl-1,3-oxazol-2-yl)pentanal?
The canonical SMILES for 5-(5-methyl-1,3-oxazol-2-yl)pentanal is Cc1cnc(CCCCC=O)o1.
What is the InChIKey of 5-(5-methyl-1,3-oxazol-2-yl)pentanal?
The InChIKey is CVKNBQSGLVWPKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-8-7-10-9(12-8)5-3-2-4-6-11/h6-7H,2-5H2,1H3.
What are the key properties of 5-(5-methyl-1,3-oxazol-2-yl)pentanal?
5-(5-methyl-1,3-oxazol-2-yl)pentanal has a molecular weight of 167.21 g/mol, XLogP of 1.89, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-methyl-1,3-oxazol-2-yl)pentanal is sourced from PubChem (CID 166976909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).