About methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate
methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate (PubChem CID 166977055) has the molecular formula C18H23N3O3
and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate.
Molecular Properties
| Compound Name | methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate |
| PubChem CID | 166977055 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate |
| SMILES | COC(=O)CCCCCNc1cccc(-c2nnc(C3CC3)o2)c1 |
| InChI | InChI=1S/C18H23N3O3/c1-23-16(22)8-3-2-4-11-19-15-7-5-6-14(12-15)18-21-20-17(24-18)13-9-10-13/h5-7,12-13,19H,2-4,8-11H2,1H3 |
| InChIKey | OYVOIKNFJZOFQG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate?
The IUPAC name of methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate (CID 166977055) is methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate.
What is the SMILES notation for methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate?
The canonical SMILES for methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate is COC(=O)CCCCCNc1cccc(-c2nnc(C3CC3)o2)c1.
What is the InChIKey of methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate?
The InChIKey is OYVOIKNFJZOFQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O3/c1-23-16(22)8-3-2-4-11-19-15-7-5-6-14(12-15)18-21-20-17(24-18)13-9-10-13/h5-7,12-13,19H,2-4,8-11H2,1H3.
What are the key properties of methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate?
methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate has a molecular weight of 329.40 g/mol, XLogP of 3.76, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)anilino]hexanoate is sourced from PubChem (CID 166977055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).