C19H24BrF3N4O2 — CID 166977261
1-(3-bromophenyl)-3-tert-butyl-1-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentyl]urea (PubChem CID 166977261) has the molecular formula C19H24BrF3N4O2 and a molecular weight of 477.33 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-tert-butyl-1-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentyl]urea.
| Compound Name | 1-(3-bromophenyl)-3-tert-butyl-1-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentyl]urea |
|---|---|
| PubChem CID | 166977261 |
| Molecular Formula | C19H24BrF3N4O2 |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 1-(3-bromophenyl)-3-tert-butyl-1-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentyl]urea |
| SMILES | CC(C)(C)NC(=O)N(CCCCCc1noc(C(F)(F)F)n1)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H24BrF3N4O2/c1-18(2,3)25-17(28)27(14-9-7-8-13(20)12-14)11-6-4-5-10-15-24-16(29-26-15)19(21,22)23/h7-9,12H,4-6,10-11H2,1-3H3,(H,25,28) |
| InChIKey | VEXQCAOSTDPRTF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|