About N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine
N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine (PubChem CID 166977656) has the molecular formula C16H30N2
and a molecular weight of 250.43 g/mol. Its IUPAC name is N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine.
Molecular Properties
| Compound Name | N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine |
| PubChem CID | 166977656 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine |
| SMILES | C=CCC(C)/C=C/C(C)CNN1CCCCCC1 |
| InChI | InChI=1S/C16H30N2/c1-4-9-15(2)10-11-16(3)14-17-18-12-7-5-6-8-13-18/h4,10-11,15-17H,1,5-9,12-14H2,2-3H3/b11-10+ |
| InChIKey | PHALBQFNDZNLDP-ZHACJKMWSA-N |
| XLogP | 3.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine?
The IUPAC name of N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine (CID 166977656) is N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine.
What is the SMILES notation for N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine?
The canonical SMILES for N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine is C=CCC(C)/C=C/C(C)CNN1CCCCCC1.
What is the InChIKey of N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine?
The InChIKey is PHALBQFNDZNLDP-ZHACJKMWSA-N. The full InChI is InChI=1S/C16H30N2/c1-4-9-15(2)10-11-16(3)14-17-18-12-7-5-6-8-13-18/h4,10-11,15-17H,1,5-9,12-14H2,2-3H3/b11-10+.
What are the key properties of N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine?
N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine has a molecular weight of 250.43 g/mol, XLogP of 3.77, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-2,5-dimethylocta-3,7-dienyl]azepan-1-amine is sourced from PubChem (CID 166977656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).