C6H14N2S — CID 166977704
2,3-bis(methylamino)but-3-ene-1-thiol (PubChem CID 166977704) has the molecular formula C6H14N2S and a molecular weight of 146.26 g/mol. Its IUPAC name is 2,3-bis(methylamino)but-3-ene-1-thiol.
| Compound Name | 2,3-bis(methylamino)but-3-ene-1-thiol |
|---|---|
| PubChem CID | 166977704 |
| Molecular Formula | C6H14N2S |
| Molecular Weight | 146.26 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 2,3-bis(methylamino)but-3-ene-1-thiol |
| SMILES | C=C(NC)C(CS)NC |
| InChI | InChI=1S/C6H14N2S/c1-5(7-2)6(4-9)8-3/h6-9H,1,4H2,2-3H3 |
| InChIKey | JYCCIZKBKGGBSR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|