C23H24F2N4O2 — CID 166977853
N-[(3E,5E)-3-amino-6-(2,4-difluorophenyl)hepta-1,3,5-trien-2-yl]-2-(methoxymethyl)-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxamide (PubChem CID 166977853) has the molecular formula C23H24F2N4O2 and a molecular weight of 426.47 g/mol. Its IUPAC name is N-[(3E,5E)-3-amino-6-(2,4-difluorophenyl)hepta-1,3,5-trien-2-yl]-2-(methoxymethyl)-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxamide.
| Compound Name | N-[(3E,5E)-3-amino-6-(2,4-difluorophenyl)hepta-1,3,5-trien-2-yl]-2-(methoxymethyl)-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 166977853 |
| Molecular Formula | C23H24F2N4O2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | N-[(3E,5E)-3-amino-6-(2,4-difluorophenyl)hepta-1,3,5-trien-2-yl]-2-(methoxymethyl)-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxamide |
| SMILES | C=C(NC(=O)N1Cc2ccc(COC)nc2C1)/C(N)=C\C=C(/C)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H24F2N4O2/c1-14(19-8-6-17(24)10-20(19)25)4-9-21(26)15(2)27-23(30)29-11-16-5-7-18(13-31-3)28-22(16)12-29/h4-10H,2,11-13,26H2,1,3H3,(H,27,30)/b14-4+,21-9+ |
| InChIKey | XHUSGJJQRHZDCI-KOHKBOBSSA-N |
| XLogP | 3.99 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|