About 1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione
1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione (PubChem CID 166977904) has the molecular formula C13H24N2O3
and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione.
Molecular Properties
| Compound Name | 1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione |
| PubChem CID | 166977904 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione |
| SMILES | CNC(C)(C)C1COCC(C)(C)N1C(=O)C(C)=O |
| InChI | InChI=1S/C13H24N2O3/c1-9(16)11(17)15-10(13(4,5)14-6)7-18-8-12(15,2)3/h10,14H,7-8H2,1-6H3 |
| InChIKey | BJAQABYWJBTFKO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione?
The IUPAC name of 1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione (CID 166977904) is 1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione.
What is the SMILES notation for 1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione?
The canonical SMILES for 1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione is CNC(C)(C)C1COCC(C)(C)N1C(=O)C(C)=O.
What is the InChIKey of 1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione?
The InChIKey is BJAQABYWJBTFKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O3/c1-9(16)11(17)15-10(13(4,5)14-6)7-18-8-12(15,2)3/h10,14H,7-8H2,1-6H3.
What are the key properties of 1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione?
1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione has a molecular weight of 256.35 g/mol, XLogP of 0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,3-dimethyl-5-[2-(methylamino)propan-2-yl]morpholin-4-yl]propane-1,2-dione is sourced from PubChem (CID 166977904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).