C35H43FN2O4 — CID 166978382
3-[(2S)-2-[4-(5-fluoro-2-methoxy-4-pyridinyl)-3-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoic acid (PubChem CID 166978382) has the molecular formula C35H43FN2O4 and a molecular weight of 574.74 g/mol. Its IUPAC name is 3-[(2S)-2-[4-(5-fluoro-2-methoxy-4-pyridinyl)-3-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoic acid.
| Compound Name | 3-[(2S)-2-[4-(5-fluoro-2-methoxy-4-pyridinyl)-3-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 166978382 |
| Molecular Formula | C35H43FN2O4 |
| Molecular Weight | 574.74 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | 3-[(2S)-2-[4-(5-fluoro-2-methoxy-4-pyridinyl)-3-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoic acid |
| SMILES | COc1cc(-c2ccc([C@@H]3CCc4ccc(CC(C)C(=O)O)cc4O3)cc2CN2C(C)(C)CCCC2(C)C)c(F)cn1 |
| InChI | InChI=1S/C35H43FN2O4/c1-22(33(39)40)16-23-8-9-24-11-13-30(42-31(24)17-23)25-10-12-27(28-19-32(41-6)37-20-29(28)36)26(18-25)21-38-34(2,3)14-7-15-35(38,4)5/h8-10,12,17-20,22,30H,7,11,13-16,21H2,1-6H3,(H,39,40)/t22?,30-/m0/s1 |
| InChIKey | XVMBTCZKKTUYEB-YBJSGSKQSA-N |
| XLogP | 7.77 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.74 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |