C16H15F3N4O2S2 — CID 166978597
2-[3-ethylsulfinyl-5-(methylsulfanylmethoxy)-2-pyridinyl]-7-(trifluoromethyl)imidazo[1,2-c]pyrimidine (PubChem CID 166978597) has the molecular formula C16H15F3N4O2S2 and a molecular weight of 416.45 g/mol. Its IUPAC name is 2-[3-ethylsulfinyl-5-(methylsulfanylmethoxy)-2-pyridinyl]-7-(trifluoromethyl)imidazo[1,2-c]pyrimidine.
| Compound Name | 2-[3-ethylsulfinyl-5-(methylsulfanylmethoxy)-2-pyridinyl]-7-(trifluoromethyl)imidazo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 166978597 |
| Molecular Formula | C16H15F3N4O2S2 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 2-[3-ethylsulfinyl-5-(methylsulfanylmethoxy)-2-pyridinyl]-7-(trifluoromethyl)imidazo[1,2-c]pyrimidine |
| SMILES | CCS(=O)c1cc(OCSC)cnc1-c1cn2cnc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C16H15F3N4O2S2/c1-3-27(24)12-4-10(25-9-26-2)6-20-15(12)11-7-23-8-21-13(16(17,18)19)5-14(23)22-11/h4-8H,3,9H2,1-2H3 |
| InChIKey | DUUVEDGIBBHRSR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|