C24H25N3O7S3 — CID 166979086
1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne-2-carbonylamino)-3-[3-(2-hydroxyethyldisulfanyl)propanoylamino]-1-oxopropane-2-sulfonic acid (PubChem CID 166979086) has the molecular formula C24H25N3O7S3 and a molecular weight of 563.68 g/mol. Its IUPAC name is 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne-2-carbonylamino)-3-[3-(2-hydroxyethyldisulfanyl)propanoylamino]-1-oxopropane-2-sulfonic acid.
| Compound Name | 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne-2-carbonylamino)-3-[3-(2-hydroxyethyldisulfanyl)propanoylamino]-1-oxopropane-2-sulfonic acid |
|---|---|
| PubChem CID | 166979086 |
| Molecular Formula | C24H25N3O7S3 |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne-2-carbonylamino)-3-[3-(2-hydroxyethyldisulfanyl)propanoylamino]-1-oxopropane-2-sulfonic acid |
| SMILES | O=C(CCSSCCO)NCC(C(=O)NC(=O)N1Cc2ccccc2C#Cc2ccccc21)S(=O)(=O)O |
| InChI | InChI=1S/C24H25N3O7S3/c28-12-14-36-35-13-11-22(29)25-15-21(37(32,33)34)23(30)26-24(31)27-16-19-7-2-1-5-17(19)9-10-18-6-3-4-8-20(18)27/h1-8,21,28H,11-16H2,(H,25,29)(H,26,30,31)(H,32,33,34) |
| InChIKey | LALZNSNBQKQYBW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|