C16H16IN3O2 — CID 166979406
4-iodo-N-(2-methyl-3-oxo-5,6,7,8-tetrahydrocinnolin-6-yl)benzamide (PubChem CID 166979406) has the molecular formula C16H16IN3O2 and a molecular weight of 409.23 g/mol. Its IUPAC name is 4-iodo-N-(2-methyl-3-oxo-5,6,7,8-tetrahydrocinnolin-6-yl)benzamide.
| Compound Name | 4-iodo-N-(2-methyl-3-oxo-5,6,7,8-tetrahydrocinnolin-6-yl)benzamide |
|---|---|
| PubChem CID | 166979406 |
| Molecular Formula | C16H16IN3O2 |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 4-iodo-N-(2-methyl-3-oxo-5,6,7,8-tetrahydrocinnolin-6-yl)benzamide |
| SMILES | Cn1nc2c(cc1=O)CC(NC(=O)c1ccc(I)cc1)CC2 |
| InChI | InChI=1S/C16H16IN3O2/c1-20-15(21)9-11-8-13(6-7-14(11)19-20)18-16(22)10-2-4-12(17)5-3-10/h2-5,9,13H,6-8H2,1H3,(H,18,22) |
| InChIKey | HITYRYINLPWBNF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|