About N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide
N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide (PubChem CID 166979428) has the molecular formula C12H22FNO2
and a molecular weight of 231.31 g/mol. Its IUPAC name is N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide |
| PubChem CID | 166979428 |
| Molecular Formula | C12H22FNO2 |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC[C@@H](F)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H22FNO2/c1-11(2,3)9(15)8(13)7-14-10(16)12(4,5)6/h8H,7H2,1-6H3,(H,14,16)/t8-/m1/s1 |
| InChIKey | IOULCBHRJNUJJI-MRVPVSSYSA-N |
| XLogP | 2.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide?
The IUPAC name of N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide (CID 166979428) is N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide is CC(C)(C)C(=O)NC[C@@H](F)C(=O)C(C)(C)C.
What is the InChIKey of N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide?
The InChIKey is IOULCBHRJNUJJI-MRVPVSSYSA-N. The full InChI is InChI=1S/C12H22FNO2/c1-11(2,3)9(15)8(13)7-14-10(16)12(4,5)6/h8H,7H2,1-6H3,(H,14,16)/t8-/m1/s1.
What are the key properties of N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide?
N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide has a molecular weight of 231.31 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-2-fluoro-4,4-dimethyl-3-oxopentyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 166979428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).